|
CAS#: 2720-77-6 Product: Potassium Cyclohexyloxymethanedithioate No suppilers available for the product. |
| Name | Potassium Cyclohexyloxymethanedithioate |
|---|---|
| Synonyms | Potassium Cyclohexoxymethanedithioate; Carbonic Acid, Dithio-, O-Cyclohexyl Ester, Potassium Salt; Carbonodithioic Acid, O-Cyclohexyl Ester, Potassium Salt (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C7H11KOS2 |
| Molecular Weight | 214.38 |
| CAS Registry Number | 2720-77-6 |
| SMILES | C1C(OC([S-])=S)CCCC1.[K+] |
| InChI | 1S/C7H12OS2.K/c9-7(10)8-6-4-2-1-3-5-6;/h6H,1-5H2,(H,9,10);/q;+1/p-1 |
| InChIKey | GZFUTXWXSUUNAK-UHFFFAOYSA-M |
| Boiling point | 226.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 90.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium Cyclohexyloxymethanedithioate |