|
CAS#: 27253-32-3 Product: Manganese Neodecanoate No suppilers available for the product. |
| Name | Manganese Neodecanoate |
|---|---|
| Synonyms | Manganous 3,3,5,5-Tetramethylhexanoate; Neodecanoic Acid, Manganese Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C20H38MnO4 |
| Molecular Weight | 397.46 |
| CAS Registry Number | 27253-32-3 |
| EINECS | 248-374-6 |
| SMILES | C(C(CC([O-])=O)(C)C)C(C)(C)C.C(C(CC([O-])=O)(C)C)C(C)(C)C.[Mn++] |
| InChI | 1S/2C10H20O2.Mn/c2*1-9(2,3)7-10(4,5)6-8(11)12;/h2*6-7H2,1-5H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | QPTLZSCCHURYRY-UHFFFAOYSA-L |
| Boiling point | 256.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 114.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Manganese Neodecanoate |