|
CAS#: 27272-54-4 Product: 1,3-Bis(4-nitrophenyl)-1,3-Diazetidine-2,4-dione No suppilers available for the product. |
| Name | 1,3-Bis(4-nitrophenyl)-1,3-Diazetidine-2,4-dione |
|---|---|
| Synonyms | 1,3-Bis(4-Nitrophenyl)-1,3-Diazetidine-2,4-Quinone; Brn 0343007; 1,3-Bis(P-Nitrophenyl)Uretidinedione |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8N4O6 |
| Molecular Weight | 328.24 |
| CAS Registry Number | 27272-54-4 |
| SMILES | C3=C(N2C(N(C1=CC=C([N+](=O)[O-])C=C1)C2=O)=O)C=CC(=C3)[N+]([O-])=O |
| InChI | 1S/C14H8N4O6/c19-13-15(9-1-5-11(6-2-9)17(21)22)14(20)16(13)10-3-7-12(8-4-10)18(23)24/h1-8H |
| InChIKey | SLEIUMJQAQQWOQ-UHFFFAOYSA-N |
| Density | 1.657g/cm3 (Cal.) |
|---|---|
| Boiling point | 533.481°C at 760 mmHg (Cal.) |
| Flash point | 276.44°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Bis(4-nitrophenyl)-1,3-Diazetidine-2,4-dione |