|
CAS#: 2729-28-4 Product: 1,1-Dichloro-1,2,2,3,3,3-Hexafluoropropane No suppilers available for the product. |
| Name | 1,1-Dichloro-1,2,2,3,3,3-Hexafluoropropane |
|---|---|
| Synonyms | 1,1-Dichloro-1,2,2,3,3,3-Hexafluoro-Propane |
| Molecular Structure | ![]() |
| Molecular Formula | C3Cl2F6 |
| Molecular Weight | 220.93 |
| CAS Registry Number | 2729-28-4 |
| EINECS | 220-344-7 |
| SMILES | ClC(C(C(F)(F)F)(F)F)(F)Cl |
| InChI | 1S/C3Cl2F6/c4-2(5,8)1(6,7)3(9,10)11 |
| InChIKey | FMKLGBFKHKIUKZ-UHFFFAOYSA-N |
| Density | 1.653g/cm3 (Cal.) |
|---|---|
| Boiling point | 36.051°C at 760 mmHg (Cal.) |
| Flash point | -21.817°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-Dichloro-1,2,2,3,3,3-Hexafluoropropane |