|
CAS#: 27304-02-5 Product: Dihydrocyperaquinone No suppilers available for the product. |
| Name | Dihydrocyperaquinone |
|---|---|
| Synonyms | 6-Isopropylidene-3-Methyl-5H-Furo[3,2-F]Benzofuran-4,8-Dione; 6-Isopropylidene-3-Methyl-5H-Furo[3,2-F]Benzofuran-4,8-Quinone; Benzo(1,2-B:5,4-B')Difuran-4,8-Dione, 2,3-Dihydro-2-Isopropenyl-5-Methyl-, (-)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 |
| CAS Registry Number | 27304-02-5 |
| SMILES | C1=C(C2=C(O1)C(=O)C3=C(C2=O)CC(O3)=C(C)C)C |
| InChI | 1S/C14H12O4/c1-6(2)9-4-8-11(15)10-7(3)5-17-14(10)12(16)13(8)18-9/h5H,4H2,1-3H3 |
| InChIKey | RMJXXSFMQXHKAC-UHFFFAOYSA-N |
| Density | 1.325g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.021°C at 760 mmHg (Cal.) |
| Flash point | 209.636°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dihydrocyperaquinone |