|
CAS#: 2731-42-2 Product: 2,3-Dihydroxybutanedioic Acid; 2-Methyl-3-Phenylbutan-2-Amine No suppilers available for the product. |
| Name | 2,3-Dihydroxybutanedioic Acid; 2-Methyl-3-Phenylbutan-2-Amine |
|---|---|
| Synonyms | 2,3-Dihydroxybutanedioic Acid; 2-Methyl-3-Phenyl-Butan-2-Amine; (1,1-Dimethyl-2-Phenyl-Propyl)Amine; Tartaric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 |
| CAS Registry Number | 2731-42-2 |
| EINECS | 220-348-9 |
| SMILES | O=C(O)C(O)C(O)C(O)=O.C1=C(C(C(N)(C)C)C)C=CC=C1 |
| InChI | 1S/C11H17N.C4H6O6/c1-9(11(2,3)12)10-7-5-4-6-8-10;5-1(3(7)8)2(6)4(9)10/h4-9H,12H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | QARISFYEQKFRIJ-UHFFFAOYSA-N |
| Boiling point | 230.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 96.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydroxybutanedioic Acid; 2-Methyl-3-Phenylbutan-2-Amine |