|
CAS#: 27343-48-2 Product: 11-Methyl-11,12,15,16-Tetrahydro-17H-Cyclopenta(a)Phenanthren-17-One No suppilers available for the product. |
| Name | 11-Methyl-11,12,15,16-Tetrahydro-17H-Cyclopenta(a)Phenanthren-17-One |
|---|---|
| Synonyms | 11-Methyl-11,12,15,16-Tetrahydro-17H-Cyclopenta(A)Phenanthren-17-One; 11-Methylgona-1,3,5(10),6,8,13-Hexaen-17-One; 17H-Cyclopenta(A)Phenanthren-17-One, 11,12,15,16-Tetrahydro-11-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O |
| Molecular Weight | 248.32 |
| CAS Registry Number | 27343-48-2 |
| SMILES | C2=CC1=CC=CC=C1C3=C2C4=C(CC3C)C(=O)CC4 |
| InChI | 1S/C18H16O/c1-11-10-16-14(8-9-17(16)19)15-7-6-12-4-2-3-5-13(12)18(11)15/h2-7,11H,8-10H2,1H3 |
| InChIKey | ADVPVYMCDBPSTD-UHFFFAOYSA-N |
| Density | 1.195g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.621°C at 760 mmHg (Cal.) |
| Flash point | 178.047°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11-Methyl-11,12,15,16-Tetrahydro-17H-Cyclopenta(a)Phenanthren-17-One |