|
CAS#: 2741-42-6 Product: Di(Phenyl)-(Phenylmethyl)Arsane No suppilers available for the product. |
| Name | Di(Phenyl)-(Phenylmethyl)Arsane |
|---|---|
| Synonyms | Benzyl-Di(Phenyl)Arsane; Antineoplastic-42474; Nsc42474 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H17As |
| Molecular Weight | 320.26 |
| CAS Registry Number | 2741-42-6 |
| SMILES | C1=CC=C(C=C1)C[As](C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C19H17As/c1-4-10-17(11-5-1)16-20(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15H,16H2 |
| InChIKey | UFJSAPNUODOOQS-UHFFFAOYSA-N |
| Boiling point | 403.454°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 193.885°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Di(Phenyl)-(Phenylmethyl)Arsane |