|
CAS#: 27450-21-1 Product: Osmadizone No suppilers available for the product. |
| Name | Osmadizone |
|---|---|
| Synonyms | 2-[Phenyl-(Phenylamino)Carbamoyl]-4-Phenylsulfinyl-Butanoic Acid; 2-[Oxo-[Phenyl-(Phenylamino)Amino]Methyl]-4-Phenylsulfinylbutanoic Acid; 2-[Phenyl-(Phenylamino)Carbamoyl]-4-Phenylsulfinyl-Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.50 |
| CAS Registry Number | 27450-21-1 |
| SMILES | C1=CC=CC=C1N(C(C(CC[S](C2=CC=CC=C2)=O)C(O)=O)=O)NC3=CC=CC=C3 |
| InChI | 1S/C23H22N2O4S/c26-22(21(23(27)28)16-17-30(29)20-14-8-3-9-15-20)25(19-12-6-2-7-13-19)24-18-10-4-1-5-11-18/h1-15,21,24H,16-17H2,(H,27,28) |
| InChIKey | AMJPXGQNYYTBKB-UHFFFAOYSA-N |
| Density | 1.375g/cm3 (Cal.) |
|---|---|
| Boiling point | 655.954°C at 760 mmHg (Cal.) |
| Flash point | 350.508°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Osmadizone |