|
CAS#: 27490-20-6 Product: 2-Methyl-2-(Trimethylsilyl)-2-Silaindan No suppilers available for the product. |
| Name | 2-Methyl-2-(Trimethylsilyl)-2-Silaindan |
|---|---|
| Synonyms | 2-Silaindan, 2-Methyl-2-(Trimethylsilyl)-; 2-Silaindan,2-Methyl-2-(Trimethylsilyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20Si2 |
| Molecular Weight | 220.46 |
| CAS Registry Number | 27490-20-6 |
| SMILES | C1=CC=CC2=C1C[Si](C2)([Si](C)(C)C)C |
| InChI | 1S/C12H20Si2/c1-13(2,3)14(4)9-11-7-5-6-8-12(11)10-14/h5-8H,9-10H2,1-4H3 |
| InChIKey | IGVMEAKDPBGCQZ-UHFFFAOYSA-N |
| Density | 0.916g/cm3 (Cal.) |
|---|---|
| Boiling point | 257.745°C at 760 mmHg (Cal.) |
| Flash point | 96.673°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-(Trimethylsilyl)-2-Silaindan |