|
CAS#: 27500-70-5 Product: 4-[(Diisopropylamino)Methyl]-3-Methoxy-9H-Xanthen-9-One No suppilers available for the product. |
| Name | 4-[(Diisopropylamino)Methyl]-3-Methoxy-9H-Xanthen-9-One |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.43 |
| CAS Registry Number | 27500-70-5 |
| SMILES | O=C1c3ccccc3Oc2c1ccc(OC)c2CN(C(C)C)C(C)C |
| InChI | 1S/C21H25NO3/c1-13(2)22(14(3)4)12-17-18(24-5)11-10-16-20(23)15-8-6-7-9-19(15)25-21(16)17/h6-11,13-14H,12H2,1-5H3 |
| InChIKey | UIJTURZGLZUDCM-UHFFFAOYSA-N |
| Density | 1.128g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.685°C at 760 mmHg (Cal.) |
| Flash point | 236.647°C (Cal.) |
| Refractive index | 1.569 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(Diisopropylamino)Methyl]-3-Methoxy-9H-Xanthen-9-One |