|
CAS#: 27574-24-9 Product: Tropatepine No suppilers available for the product. |
| Name | Tropatepine |
|---|---|
| Synonyms | Tropatepine [Dcf:Inn]; Tropatepinum [Inn-Latin]; 1-Alpha-H,5-Alpha-H-Tropane, 3-Dibenzo(B,E)Thiepin-11(6H)-Ylidene- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H23NS |
| Molecular Weight | 333.49 |
| CAS Registry Number | 27574-24-9 |
| SMILES | [C@@H]45N([C@H](CC(=C1/C3=C(SCC2=CC=CC=C12)C=CC=C3)/C4)CC5)C |
| InChI | 1S/C22H23NS/c1-23-17-10-11-18(23)13-16(12-17)22-19-7-3-2-6-15(19)14-24-21-9-5-4-8-20(21)22/h2-9,17-18H,10-14H2,1H3/t17-,18-/m0/s1 |
| InChIKey | JOQKFRLFXDPXHX-ROUUACIJSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.127°C at 760 mmHg (Cal.) |
| Flash point | 252.034°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tropatepine |