Online Database of Chemicals from Around the World
| Name | 2-[(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecyl)Amino]Ethanol |
|---|---|
| Synonyms | 2-((3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecyl)Amino)Ethanol |
| Molecular Structure | ![CAS#: 27607-42-7, 2-[(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecyl)Amino]Ethanol](/moreStructures/27607-42-7.gif) |
| Molecular Formula | C12H10F17NO |
| Molecular Weight | 507.19 |
| CAS Registry Number | 27607-42-7 |
| EINECS | 248-563-3 |
| SMILES | C(NCCO)CC(C(C(C(C(C(C(F)(F)C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| InChI | 1S/C12H10F17NO/c13-5(14,1-2-30-3-4-31)6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)11(25,26)12(27,28)29/h30-31H,1-4H2 |
| InChIKey | AFNLZEWJLHEBLO-UHFFFAOYSA-N |
| Density | 1.556g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.76°C at 760 mmHg (Cal.) |
| Flash point | 115.133°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecyl)Amino]Ethanol |
