|
CAS#: 2761-22-0 Product: 1-Isocyanato-4-(4-Isocyanatophenyl)Benzene No suppilers available for the product. |
| Name | 1-Isocyanato-4-(4-Isocyanatophenyl)Benzene |
|---|---|
| Synonyms | Nsc511732; 4,4'-Biphenyldiisocyanate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8N2O2 |
| Molecular Weight | 236.23 |
| CAS Registry Number | 2761-22-0 |
| SMILES | O=C=NC2=CC=C(C1=CC=C(C=C1)N=C=O)C=C2 |
| InChI | 1S/C14H8N2O2/c17-9-15-13-5-1-11(2-6-13)12-3-7-14(8-4-12)16-10-18/h1-8H |
| InChIKey | RQBUVIFBALZGPC-UHFFFAOYSA-N |
| Density | 1.153g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.197°C at 760 mmHg (Cal.) |
| Flash point | 149.268°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Isocyanato-4-(4-Isocyanatophenyl)Benzene |