Online Database of Chemicals from Around the World
|
CAS#: 27683-61-0 Product: 1,1-Bis(4-Chlorophenyl)-2,2-Dichloroethanol No suppilers available for the product. |
| Name | 1,1-Bis(4-Chlorophenyl)-2,2-Dichloroethanol |
|---|---|
| Synonyms | 1-(M-Chlorophenyl)-2,2-Dichloroethanol; Benzyl Alcohol, M-Chloro-Alpha-(Dichloromethyl)-; Brn 1952839 |
| Molecular Structure |  |
| Molecular Formula | C8H7Cl3O |
| Molecular Weight | 225.50 |
| CAS Registry Number | 27683-61-0 |
| SMILES | C1=CC=C(C=C1C(O)C(Cl)Cl)Cl |
| InChI | 1S/C8H7Cl3O/c9-6-3-1-2-5(4-6)7(12)8(10)11/h1-4,7-8,12H |
| InChIKey | INLMRTPMNPOFAV-UHFFFAOYSA-N |
| Density | 1.449g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.223°C at 760 mmHg (Cal.) |
| Flash point | 141.418°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,1-Bis(4-Chlorophenyl)-2,2-Dichloroethanol |