|
CAS#: 2769-94-0 Product: 2,4-Bis(1-Phenylethyl)Phenol No suppilers available for the product. |
| Name | 2,4-Bis(1-Phenylethyl)Phenol |
|---|---|
| Synonyms | Ai3-08264; Phenol, 2,4-Bis(1-Phenylethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H22O |
| Molecular Weight | 302.42 |
| CAS Registry Number | 2769-94-0 (25640-70-4) |
| EINECS | 220-460-8 |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=C(C=C2)O)C(C3=CC=CC=C3)C)C |
| InChI | 1S/C22H22O/c1-16(18-9-5-3-6-10-18)20-13-14-22(23)21(15-20)17(2)19-11-7-4-8-12-19/h3-17,23H,1-2H3 |
| InChIKey | RCFAHSGZAAFQJH-UHFFFAOYSA-N |
| Density | 1.076g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.398°C at 760 mmHg (Cal.) |
| Flash point | 201.22°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Bis(1-Phenylethyl)Phenol |