|
CAS#: 27708-63-0 Product: Dipotassium Isooctyl Phosphate No suppilers available for the product. |
| Name | Dipotassium Isooctyl Phosphate |
|---|---|
| Synonyms | Dipotassium Isooctyl Phosphate; Isooctyl Alcohol, Dihydrogen Phosphate Dipotassium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C8H19K2O4P |
| Molecular Weight | 288.41 |
| CAS Registry Number | 27708-63-0 |
| EINECS | 248-619-7 |
| SMILES | C(CCCCO[P](O)(O)=O)C(C)C.[K+].[K+] |
| InChI | 1S/C8H19O4P.2K/c1-8(2)6-4-3-5-7-12-13(9,10)11;;/h8H,3-7H2,1-2H3,(H2,9,10,11);;/q;2*+1 |
| InChIKey | MOJYYOPFOKMPCJ-UHFFFAOYSA-N |
| Boiling point | 321.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 148.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dipotassium Isooctyl Phosphate |