|
CAS#: 27725-17-3 Product: 2,2'-Methylenebis[4-(1,1,3,3-Tetramethylbutyl)Phenol] No suppilers available for the product. |
| Name | 2,2'-Methylenebis[4-(1,1,3,3-Tetramethylbutyl)Phenol] |
|---|---|
| Synonyms | 2-[[2-Hydroxy-5-(1,1,3,3-Tetramethylbutyl)Phenyl]Methyl]-4-(1,1,3,3-Tetramethylbutyl)Phenol; 2-[2-Hydroxy-5-(1,1,3,3-Tetramethylbutyl)Benzyl]-4-(1,1,3,3-Tetramethylbutyl)Phenol; 2,2'-Methylenebis(4-(1,1,3,3-Tetramethylbutyl)Phenol) |
| Molecular Structure | ![]() |
| Molecular Formula | C29H44O2 |
| Molecular Weight | 424.67 |
| CAS Registry Number | 27725-17-3 |
| EINECS | 248-621-8 |
| SMILES | C1=CC(=CC(=C1O)CC2=C(O)C=CC(=C2)C(CC(C)(C)C)(C)C)C(CC(C)(C)C)(C)C |
| InChI | 1S/C29H44O2/c1-26(2,3)18-28(7,8)22-11-13-24(30)20(16-22)15-21-17-23(12-14-25(21)31)29(9,10)19-27(4,5)6/h11-14,16-17,30-31H,15,18-19H2,1-10H3 |
| InChIKey | NHKWEDRAPLIPAU-UHFFFAOYSA-N |
| Density | 0.985g/cm3 (Cal.) |
|---|---|
| Boiling point | 518.813°C at 760 mmHg (Cal.) |
| Flash point | 209.779°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Methylenebis[4-(1,1,3,3-Tetramethylbutyl)Phenol] |