|
CAS#: 2778-41-8 Product: 1,4-Bis(2-Isocyanatopropan-2-Yl)Benzene No suppilers available for the product. |
| Name | 1,4-Bis(2-Isocyanatopropan-2-Yl)Benzene |
|---|---|
| Synonyms | 1,4-Bis(1-Isocyanato-1-Methyl-Ethyl)Benzene; 1,4-Bis(1-Isocyanato-1-Methylethyl)Benzene; Brn 2741545 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 |
| CAS Registry Number | 2778-41-8 |
| EINECS | 220-473-9 |
| SMILES | O=C=NC(C1=CC=C(C=C1)C(C)(C)N=C=O)(C)C |
| InChI | 1S/C14H16N2O2/c1-13(2,15-9-17)11-5-7-12(8-6-11)14(3,4)16-10-18/h5-8H,1-4H3 |
| InChIKey | AGJCSCSSMFRMFQ-UHFFFAOYSA-N |
| Density | 1.015g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.513°C at 760 mmHg (Cal.) |
| Flash point | 135.545°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Bis(2-Isocyanatopropan-2-Yl)Benzene |