|
CAS#: 27954-37-6 Product: 1,1-Dimethyl-3-[3-(1,1,2,2-Tetrafluoroethoxy)Phenyl]Urea No suppilers available for the product. |
| Name | 1,1-Dimethyl-3-[3-(1,1,2,2-Tetrafluoroethoxy)Phenyl]Urea |
|---|---|
| Synonyms | 1,1-Dimethyl-3-(3-(1,1,2,2-Tetrafluoroethoxy)Phenyl)Urea; Brn 2946835 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12F4N2O2 |
| Molecular Weight | 280.22 |
| CAS Registry Number | 27954-37-6 |
| EINECS | 248-746-8 |
| SMILES | C1=C(OC(C(F)F)(F)F)C=CC=C1NC(N(C)C)=O |
| InChI | 1S/C11H12F4N2O2/c1-17(2)10(18)16-7-4-3-5-8(6-7)19-11(14,15)9(12)13/h3-6,9H,1-2H3,(H,16,18) |
| InChIKey | FCAKZZMVXCLLHM-UHFFFAOYSA-N |
| Density | 1.341g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.792°C at 760 mmHg (Cal.) |
| Flash point | 172.606°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-Dimethyl-3-[3-(1,1,2,2-Tetrafluoroethoxy)Phenyl]Urea |