|
CAS#: 28017-79-0 Product: 3-Isopropyl-5,5-Dimethyl-2-Cyclohexen-1-One No suppilers available for the product. |
| Name | 3-Isopropyl-5,5-Dimethyl-2-Cyclohexen-1-One |
|---|---|
| Synonyms | 3-Isopropyl-5,5-dimethyl-2-cyclohexen-1-one # |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 |
| CAS Registry Number | 28017-79-0 |
| SMILES | O=C1\C=C(/CC(C)(C)C1)C(C)C |
| InChI | 1S/C11H18O/c1-8(2)9-5-10(12)7-11(3,4)6-9/h5,8H,6-7H2,1-4H3 |
| InChIKey | MYUGFXPFGVRZED-UHFFFAOYSA-N |
| Density | 0.9g/cm3 (Cal.) |
|---|---|
| Boiling point | 231.147°C at 760 mmHg (Cal.) |
| Flash point | 94.517°C (Cal.) |
| Refractive index | 1.46 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Isopropyl-5,5-Dimethyl-2-Cyclohexen-1-One |