Online Database of Chemicals from Around the World
|
CAS#: 28024-16-0 Product: Ethyl Isopentyl Succinate No suppilers available for the product. |
| Name | Ethyl Isopentyl Succinate |
|---|---|
| Synonyms | Isopentyl Ethyl Butanedioate; Butanedioic Acid Isopentyl Ester Ethyl Ester; Succinic Acid Isoamyl Ester Ethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 |
| CAS Registry Number | 28024-16-0 |
| EINECS | 248-784-5 |
| SMILES | C(C(OCC)=O)CC(=O)OCCC(C)C |
| InChI | 1S/C11H20O4/c1-4-14-10(12)5-6-11(13)15-8-7-9(2)3/h9H,4-8H2,1-3H3 |
| InChIKey | GCXHTVAWZRIFAV-UHFFFAOYSA-N |
| Density | 0.995g/cm3 (Cal.) |
|---|---|
| Boiling point | 249.035°C at 760 mmHg (Cal.) |
| Flash point | 110.16°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl Isopentyl Succinate |