|
CAS#: 2807-91-2 Product: 4-Dimethylamino-2-Ethyl-2-Naphthalen-1-Ylbutanamide No suppilers available for the product. |
| Name | 4-Dimethylamino-2-Ethyl-2-Naphthalen-1-Ylbutanamide |
|---|---|
| Synonyms | 4-Dimethylamino-2-Ethyl-2-(1-Naphthyl)Butanamide; 4-Dimethylamino-2-Ethyl-2-(1-Naphthyl)Butyramide; 4-Dimethylamino-2-Ethyl-2-Naphthalen-1-Yl-Butanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 |
| CAS Registry Number | 2807-91-2 |
| SMILES | C1=CC=C2C(=C1C(C(=O)N)(CCN(C)C)CC)C=CC=C2 |
| InChI | 1S/C18H24N2O/c1-4-18(17(19)21,12-13-20(2)3)16-11-7-9-14-8-5-6-10-15(14)16/h5-11H,4,12-13H2,1-3H3,(H2,19,21) |
| InChIKey | AVSPYQKJZIZMFT-UHFFFAOYSA-N |
| Density | 1.076g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.512°C at 760 mmHg (Cal.) |
| Flash point | 242.591°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Dimethylamino-2-Ethyl-2-Naphthalen-1-Ylbutanamide |