Online Database of Chemicals from Around the World
| Name | Phenyl(2,6-Dimethylphenyl)Methane |
|---|---|
| Synonyms | 2-(Benzyl)-1,3-Dimethyl-Benzene; Benzene, 2,6-Dimethyl-1-(Phenylmethyl)-; 2-Benzyl-1,3-Dimethylbenzene |
| Molecular Structure |  |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 |
| CAS Registry Number | 28122-29-4 |
| SMILES | C1=CC=C(C)C(=C1C)CC2=CC=CC=C2 |
| InChI | 1S/C15H16/c1-12-7-6-8-13(2)15(12)11-14-9-4-3-5-10-14/h3-10H,11H2,1-2H3 |
| InChIKey | OHSBKRHTPKHMQA-UHFFFAOYSA-N |
| Density | 0.975g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.984°C at 760 mmHg (Cal.) |
| Flash point | 138.031°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl(2,6-Dimethylphenyl)Methane |
