|
CAS#: 2813-22-1 Product: 2-Methylsulfinyl-1-Phenylethanone No suppilers available for the product. |
| Name | 2-Methylsulfinyl-1-Phenylethanone |
|---|---|
| Synonyms | 2-Methylsulfinyl-1-Phenyl-Ethanone; Ethanone, 2-(Methylsulfinyl)-1-Phenyl-; Methyl Phenacyl Sulfoxide |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 |
| CAS Registry Number | 2813-22-1 |
| SMILES | C1=C(C(=O)C[S](=O)C)C=CC=C1 |
| InChI | 1S/C9H10O2S/c1-12(11)7-9(10)8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | MJYVAVACHZIDHQ-UHFFFAOYSA-N |
| Density | 1.24g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.105°C at 760 mmHg (Cal.) |
| Flash point | 189.729°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylsulfinyl-1-Phenylethanone |