| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Beta Pharma Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (203) 315-5062 / (877) 786-1922 | |||
![]() |
sales@betapharma.com, | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1-(4-Benzylphenyl)-2-Bromoethanone |
|---|---|
| Synonyms | 1-(4-Benzylphenyl)-2-bromethanon; 1-(4-Benzylphenyl)-2-bromoethanone; 1-(4-Benzylphényl)-2-bromoéthanone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13BrO |
| Molecular Weight | 289.17 |
| CAS Registry Number | 28179-31-9 |
| SMILES | c1ccc(cc1)Cc2ccc(cc2)C(=O)CBr |
| InChI | 1S/C15H13BrO/c16-11-15(17)14-8-6-13(7-9-14)10-12-4-2-1-3-5-12/h1-9H,10-11H2 |
| InChIKey | NQCDWNLRZLJRSK-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 123-127°C (Expl.) |
| Boiling point | 386.7±30.0°C at 760 mmHg (Cal.) |
| Flash point | 64.5±11.9°C (Cal.) |
| Refractive index | 1.603 (Cal.) |
| Safety Description | DANGER: CORROSIVE, burns skin and eyes |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(4-Benzylphenyl)-2-Bromoethanone |