|
CAS#: 28237-14-1 Product: 9,10-Dihydro-2-Methyl-4H-Benzo[5,6]Cyclohept[1,2-d]Oxazol-4-Ol No suppilers available for the product. |
| Name | 9,10-Dihydro-2-Methyl-4H-Benzo[5,6]Cyclohept[1,2-d]Oxazol-4-Ol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 |
| CAS Registry Number | 28237-14-1 |
| EINECS | 248-922-4 |
| SMILES | C1=CC=CC3=C1C(O)C2=C(N=C(O2)C)CC3 |
| InChI | 1S/C13H13NO2/c1-8-14-11-7-6-9-4-2-3-5-10(9)12(15)13(11)16-8/h2-5,12,15H,6-7H2,1H3 |
| InChIKey | UTIRYRYPHRZIPA-UHFFFAOYSA-N |
| Density | 1.244g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.09°C at 760 mmHg (Cal.) |
| Flash point | 173.995°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9,10-Dihydro-2-Methyl-4H-Benzo[5,6]Cyclohept[1,2-d]Oxazol-4-Ol |