|
CAS#: 28291-10-3 Product: DL-trans-4-Chlorostilbene oxide No suppilers available for the product. |
| Name | DL-trans-4-Chlorostilbene oxide |
|---|---|
| Synonyms | (2S,3S)-2-(4-Chlorophenyl)-3-Phenyl-Oxirane; 2-(4-Chlorophenyl)-3-Phenyloxirane Trans-; Oxirane, 2-(4-Chlorophenyl)-3-Phenyl-, Trans- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11ClO |
| Molecular Weight | 230.69 |
| CAS Registry Number | 28291-10-3 |
| SMILES | [C@H]1(O[C@H]1C2=CC=CC=C2)C3=CC=C(C=C3)Cl |
| InChI | 1S/C14H11ClO/c15-12-8-6-11(7-9-12)14-13(16-14)10-4-2-1-3-5-10/h1-9,13-14H/t13-,14-/m0/s1 |
| InChIKey | AWZJRRBGXZWVOY-KBPBESRZSA-N |
| Density | 1.25g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.447°C at 760 mmHg (Cal.) |
| Flash point | 155.984°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for DL-trans-4-Chlorostilbene oxide |