|
CAS#: 2835-58-7 Product: 2-(Phenylazo)Aniline No suppilers available for the product. |
| Name | 2-(Phenylazo)Aniline |
|---|---|
| Synonyms | 2-Phenylazoaniline; (2-Phenylazophenyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 |
| CAS Registry Number | 2835-58-7 |
| EINECS | 220-610-2 |
| SMILES | C1=C(C(=CC=C1)N)N=NC2=CC=CC=C2 |
| InChI | 1S/C12H11N3/c13-11-8-4-5-9-12(11)15-14-10-6-2-1-3-7-10/h1-9H,13H2 |
| InChIKey | KQZBSZUGKSCFBL-UHFFFAOYSA-N |
| Density | 1.127g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.373°C at 760 mmHg (Cal.) |
| Flash point | 172.957°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Phenylazo)Aniline |