|
CAS#: 28362-31-4 Product: 1,4-Bis(Dihydroxyboryl)-2-Nitrobenzene No suppilers available for the product. |
| Name | 1,4-Bis(Dihydroxyboryl)-2-Nitrobenzene |
|---|---|
| Synonyms | (4-Borono-2-Nitro-Phenyl)Boronic Acid; [4-(Dihydroxyboranyl)-2-Nitro-Phenyl]Boronic Acid; 2-Nitrobenzene-1,4-Diboronic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C6H7B2NO6 |
| Molecular Weight | 210.74 |
| CAS Registry Number | 28362-31-4 |
| SMILES | C1=CC(=C(C=C1B(O)O)[N+]([O-])=O)B(O)O |
| InChI | 1S/C6H7B2NO6/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15/h1-3,10-13H |
| InChIKey | GGASDGRERPDUQP-UHFFFAOYSA-N |
| Density | 1.551g/cm3 (Cal.) |
|---|---|
| Boiling point | 507.454°C at 760 mmHg (Cal.) |
| Flash point | 260.699°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Bis(Dihydroxyboryl)-2-Nitrobenzene |