Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,2-Dichloro-N-[3-(Trifluoromethyl)Phenyl]Acetamide |
|---|---|
| Synonyms | 2,2-Dichloro-N-[3-(Trifluoromethyl)Phenyl]Ethanamide; 2,2-Dichloro-N-(3-(Trifluoromethyl)Phenyl)Acetamide |
| Molecular Structure | ![CAS#: 2837-61-8, 2,2-Dichloro-N-[3-(Trifluoromethyl)Phenyl]Acetamide](/moreStructures/2837-61-8.gif) |
| Molecular Formula | C9H6Cl2F3NO |
| Molecular Weight | 272.05 |
| CAS Registry Number | 2837-61-8 |
| EINECS | 220-628-0 |
| SMILES | C1=C(C=CC=C1NC(C(Cl)Cl)=O)C(F)(F)F |
| InChI | 1S/C9H6Cl2F3NO/c10-7(11)8(16)15-6-3-1-2-5(4-6)9(12,13)14/h1-4,7H,(H,15,16) |
| InChIKey | IVMXNTACFUFRFU-UHFFFAOYSA-N |
| Density | 1.518g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.322°C at 760 mmHg (Cal.) |
| Flash point | 155.388°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2-Dichloro-N-[3-(Trifluoromethyl)Phenyl]Acetamide |