|
CAS#: 28387-62-4 Product: [3R-(3alpha,3abeta,7beta,8aalpha)]-2,3,4,7,8,8alpha-Hexahydro-3,8,8-Trimethyl-1H-3a,7-Methanoazulene-6-Carboxaldehyde No suppilers available for the product. |
| Name | [3R-(3alpha,3abeta,7beta,8aalpha)]-2,3,4,7,8,8alpha-Hexahydro-3,8,8-Trimethyl-1H-3a,7-Methanoazulene-6-Carboxaldehyde |
|---|---|
| Synonyms | 1H-3A,7-Methanoazulene-6-Carboxaldehyde, 2,3,4,7,8,8A-Hexahydro-3,8,8-Trimethyl-, (3R,3As,7R,8As)-; Cedr-8-En-15-Al |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 |
| CAS Registry Number | 28387-62-4 |
| EINECS | 249-003-0 |
| SMILES | CC1(C3C2(CC1C(=CC2)C=O)C(CC3)C)C |
| InChI | 1S/C15H22O/c1-10-4-5-13-14(2,3)12-8-15(10,13)7-6-11(12)9-16/h6,9-10,12-13H,4-5,7-8H2,1-3H3 |
| InChIKey | OETRFUZAVAFOBR-UHFFFAOYSA-N |
| Density | 1.026g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.445°C at 760 mmHg (Cal.) |
| Flash point | 129.048°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [3R-(3alpha,3abeta,7beta,8aalpha)]-2,3,4,7,8,8alpha-Hexahydro-3,8,8-Trimethyl-1H-3a,7-Methanoazulene-6-Carboxaldehyde |