|
CAS#: 28460-08-4 Product: N,N-Diethylcarbamic Acid 2-Tert-Butylphenyl Ester No suppilers available for the product. |
| Name | N,N-Diethylcarbamic Acid 2-Tert-Butylphenyl Ester |
|---|---|
| Synonyms | N,N-Diethylcarbamic Acid (2-Tert-Butylphenyl) Ester; O-Tert-Butylphenol Diethylcarbamate; Brn 2696729 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 |
| CAS Registry Number | 28460-08-4 |
| SMILES | C1=C(C(=CC=C1)OC(N(CC)CC)=O)C(C)(C)C |
| InChI | 1S/C15H23NO2/c1-6-16(7-2)14(17)18-13-11-9-8-10-12(13)15(3,4)5/h8-11H,6-7H2,1-5H3 |
| InChIKey | ILLWWCPTMOEPDC-UHFFFAOYSA-N |
| Density | 0.995g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.958°C at 760 mmHg (Cal.) |
| Flash point | 153.958°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Diethylcarbamic Acid 2-Tert-Butylphenyl Ester |