Online Database of Chemicals from Around the World
|
CAS#: 28512-55-2 Product: Anthra[1,2-e]Acephenanthrylene No suppilers available for the product. |
| Name | Anthra[1,2-e]Acephenanthrylene |
|---|---|
| Synonyms | 1,2:10,11-Dibenzoperylene |
| Molecular Structure | ![CAS#: 28512-55-2, Anthra[1,2-e]Acephenanthrylene](/moreStructures/28512-55-2.gif) |
| Molecular Formula | C28H16 |
| Molecular Weight | 352.43 |
| CAS Registry Number | 28512-55-2 |
| SMILES | C1=C7C(=C3C2=C1C4=C(C2=CC=C3)C5=C(C=C4)C=C6C(=C5)C=CC=C6)C=CC=C7 |
| InChI | 1S/C28H16/c1-2-7-18-15-25-20(14-17(18)6-1)12-13-23-26-16-19-8-3-4-9-21(19)22-10-5-11-24(27(23)25)28(22)26/h1-16H |
| InChIKey | MPPRFVATAIGMDS-UHFFFAOYSA-N |
| Density | 1.333g/cm3 (Cal.) |
|---|---|
| Boiling point | 629.299°C at 760 mmHg (Cal.) |
| Flash point | 330.53°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Anthra[1,2-e]Acephenanthrylene |