|
CAS#: 28529-01-3 Product: 18-Benzylideneyohimban-17-Ol No suppilers available for the product. |
| Name | 18-Benzylideneyohimban-17-Ol |
|---|---|
| Synonyms | 18-Benzylideneyohimban-17-Ol; Yohimban-17-Ol, 18-Benzylidene- |
| Molecular Structure | ![]() |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 |
| CAS Registry Number | 28529-01-3 |
| SMILES | [C@H]13C5=C(CCN1C[C@@H]2C\C(C(C[C@H]2C3)O)=C\C4=CC=CC=C4)C6=C([NH]5)C=CC=C6 |
| InChI | 1S/C26H28N2O/c29-25-15-18-14-24-26-22(21-8-4-5-9-23(21)27-26)10-11-28(24)16-20(18)13-19(25)12-17-6-2-1-3-7-17/h1-9,12,18,20,24-25,27,29H,10-11,13-16H2/b19-12-/t18-,20+,24+,25?/m1/s1 |
| InChIKey | BRAKELMHNDSLJA-ZEMSXUJDSA-N |
| Density | 1.276g/cm3 (Cal.) |
|---|---|
| Boiling point | 609.398°C at 760 mmHg (Cal.) |
| Flash point | 322.353°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 18-Benzylideneyohimban-17-Ol |