|
CAS#: 28543-37-5 Product: Anthraniloyl Glucuronide No suppilers available for the product. |
| Name | Anthraniloyl Glucuronide |
|---|---|
| Synonyms | (2S,3S,4S,5R,6S)-6-(2-Aminobenzoyl)Oxy-3,4,5-Trihydroxy-Tetrahydropyran-2-Carboxylic Acid; (2S,3S,4S,5R,6S)-6-[(2-Aminophenyl)-Oxomethoxy]-3,4,5-Trihydroxy-2-Tetrahydropyrancarboxylic Acid; (2S,3S,4S,5R,6S)-6-(2-Aminophenyl)Carbonyloxy-3,4,5-Trihydroxy-Oxane-2-Carboxylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15NO8 |
| Molecular Weight | 313.26 |
| CAS Registry Number | 28543-37-5 |
| SMILES | [C@@H]1([C@H](O)[C@@H](O)[C@H](O)[C@H](O1)C(=O)O)OC(C2=CC=CC=C2N)=O |
| InChI | 1S/C13H15NO8/c14-6-4-2-1-3-5(6)12(20)22-13-9(17)7(15)8(16)10(21-13)11(18)19/h1-4,7-10,13,15-17H,14H2,(H,18,19)/t7-,8-,9+,10-,13-/m0/s1 |
| InChIKey | CDQXGNARPNZQNG-UNLLLRGISA-N |
| Density | 1.659g/cm3 (Cal.) |
|---|---|
| Boiling point | 616.52°C at 760 mmHg (Cal.) |
| Flash point | 326.659°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Anthraniloyl Glucuronide |