|
CAS#: 28548-08-5 Product: 12-Ketoendrin No suppilers available for the product. |
| Name | 12-Ketoendrin |
|---|---|
| Synonyms | 2,7:3,6-Dimethanonaphth[2,3-B]Oxiren-8-One, 3,4,5,6,9,9-Hexachloro-1A,2,2A,3,6,6A,7,7A-Octahydro-, (1A.Alpha.,2.Beta.,2A.Alpha.,3.Beta.,6.Beta.,6A.Alpha.,7.Beta.,7A.Alpha.)-; 1,4:5,8-Dimethanonaphthalen-9-One, 1,2,3,4,10,10-Hexachloro-6,7-Epoxy-1,4,4A,5,6; 1,4:5,8-Dimethanonaphthalen-9-One, 1,2,3,4,10,10-Hexachloro-6,7-Epoxy-1,4,4A,5,6,7,8,8A-Octahydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Cl6O2 |
| Molecular Weight | 394.90 |
| CAS Registry Number | 28548-08-5 |
| SMILES | O=C1C2C5C(C1C3C2C4(C(C3(Cl)C(=C4Cl)Cl)(Cl)Cl)Cl)O5 |
| InChI | 1S/C12H6Cl6O2/c13-8-9(14)11(16)4-2-5(19)1(6-7(2)20-6)3(4)10(8,15)12(11,17)18/h1-4,6-7H |
| InChIKey | PRGKTAHLUABTPM-UHFFFAOYSA-N |
| Density | 1.946g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.509°C at 760 mmHg (Cal.) |
| Flash point | 190.038°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 12-Ketoendrin |