|
CAS#: 28558-32-9 Product: Thiabendazole Hypophosphite No suppilers available for the product. |
| Name | Thiabendazole Hypophosphite |
|---|---|
| Synonyms | Phosphenous Acid; 2-Thiazol-4-Yl-1H-Benzimidazole; Phosphenous Acid; 2-(4-Thiazolyl)-1H-Benzimidazole; 2-(4-Thiazolyl)Benzimidazole, Hypophosphite Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8N3O2PS |
| Molecular Weight | 265.23 |
| CAS Registry Number | 28558-32-9 |
| SMILES | O=PO.C1=CC=CC2=C1[NH]C(=N2)C3=CSC=N3 |
| InChI | 1S/C10H7N3S.HO2P/c1-2-4-8-7(3-1)12-10(13-8)9-5-14-6-11-9;1-3-2/h1-6H,(H,12,13);(H,1,2) |
| InChIKey | WRCLPOMBSNHUQA-UHFFFAOYSA-N |
| Boiling point | 446°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 226.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Thiabendazole Hypophosphite |