|
CAS#: 2869-12-7 Product: 7-Methyldibenzo[h,rst]Pentaphene No suppilers available for the product. |
| Name | 7-Methyldibenzo[h,rst]Pentaphene |
|---|---|
| Synonyms | 2'-Methyl-1,2:4,5:8,9-Tribenzopyrene; 7-Methyldibenzo(H,Rst)Pentaphene; Brn 2541302 |
| Molecular Structure | ![]() |
| Molecular Formula | C29H18 |
| Molecular Weight | 366.46 |
| CAS Registry Number | 2869-12-7 |
| SMILES | C1=CC=CC2=C1C5=C3C(=C2)C7=C(C4=CC6=C(C(=C34)C=C5)C=CC=C6)C=CC(=C7)C |
| InChI | 1S/C29H18/c1-17-10-11-22-25(14-17)27-16-19-7-3-5-9-21(19)24-13-12-23-20-8-4-2-6-18(20)15-26(22)28(23)29(24)27/h2-16H,1H3 |
| InChIKey | LVCRYYLZLNGYDT-UHFFFAOYSA-N |
| Density | 1.306g/cm3 (Cal.) |
|---|---|
| Boiling point | 637.613°C at 760 mmHg (Cal.) |
| Flash point | 336.431°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Methyldibenzo[h,rst]Pentaphene |