|
CAS#: 28740-81-0 Product: 7-[(Dimethylamino)Methyl]-3,4-Dihydropyrrolo[1,2,3-ef]-1,5-Benzodiazepin-2(1H)-One No suppilers available for the product. |
| Name | 7-[(Dimethylamino)Methyl]-3,4-Dihydropyrrolo[1,2,3-ef]-1,5-Benzodiazepin-2(1H)-One |
|---|---|
| Synonyms | Brn 0754553; Pyrrolo(1,2,3-Ef)(1,5)Benzodiazepin-6(7H)-One, 4,5-Dihydro-1-((Dimethylamino)Methyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 |
| CAS Registry Number | 28740-81-0 |
| SMILES | C1=C(C3=C2[N]1CCC(=O)NC2=CC=C3)CN(C)C |
| InChI | 1S/C14H17N3O/c1-16(2)8-10-9-17-7-6-13(18)15-12-5-3-4-11(10)14(12)17/h3-5,9H,6-8H2,1-2H3,(H,15,18) |
| InChIKey | ONKWUZYEKDTIKR-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.876°C at 760 mmHg (Cal.) |
| Flash point | 233.134°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-[(Dimethylamino)Methyl]-3,4-Dihydropyrrolo[1,2,3-ef]-1,5-Benzodiazepin-2(1H)-One |