|
CAS#: 28837-79-8 Product: N-(3-(Dimethylamino)Propyl)-3-Formyl-5-Methoxy-Indole-2-Carboxamide No suppilers available for the product. |
| Name | N-(3-(Dimethylamino)Propyl)-3-Formyl-5-Methoxy-Indole-2-Carboxamide |
|---|---|
| Synonyms | N-(3-Dimethylaminopropyl)-3-Methanoyl-5-Methoxy-1H-Indole-2-Carboxamide; N-(3-(Dimethylamino)Propyl)-3-Formyl-5-Methoxyindole-2-Carboxamide; Brn 0423547 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 |
| CAS Registry Number | 28837-79-8 |
| SMILES | C1=C(C=CC2=C1C(=C([NH]2)C(=O)NCCCN(C)C)C=O)OC |
| InChI | 1S/C16H21N3O3/c1-19(2)8-4-7-17-16(21)15-13(10-20)12-9-11(22-3)5-6-14(12)18-15/h5-6,9-10,18H,4,7-8H2,1-3H3,(H,17,21) |
| InChIKey | IHNSSXHRUPMZHF-UHFFFAOYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 543.976°C at 760 mmHg (Cal.) |
| Flash point | 282.787°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3-(Dimethylamino)Propyl)-3-Formyl-5-Methoxy-Indole-2-Carboxamide |