|
CAS#: 288399-48-4 Product: 3-Bromo-6,7-Dichloro-4H-Chromen-4-One No suppilers available for the product. |
| Name | 3-Bromo-6,7-Dichloro-4H-Chromen-4-One |
|---|---|
| Synonyms | 3-Brom-6,7-dichlor-4H-chromen-4-on; 3-Bromo-6,7-dichloro-4H-chromen-4-one |
| Molecular Structure | ![]() |
| Molecular Formula | C9H3BrCl2O2 |
| Molecular Weight | 293.93 |
| CAS Registry Number | 288399-48-4 |
| SMILES | c1c2c(cc(c1Cl)Cl)occ(c2=O)Br |
| InChI | 1S/C9H3BrCl2O2/c10-5-3-14-8-2-7(12)6(11)1-4(8)9(5)13/h1-3H |
| InChIKey | CQUPCLAJTACPCV-UHFFFAOYSA-N |
| Density | 1.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.7±42.0°C at 760 mmHg (Cal.) |
| Flash point | 174.9±27.9°C (Cal.) |
| Refractive index | 1.671 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Bromo-6,7-Dichloro-4H-Chromen-4-One |