|
CAS#: 2896-87-9 Product: Ferrous glutamate No suppilers available for the product. |
| Name | Ferrous glutamate |
|---|---|
| Synonyms | Ferrous (2S)-2-Aminopentanedioate; Ferrous (2S)-2-Aminoglutarate; Glutamic Acid, Iron (2+) Salt (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C5H7FeNO4 |
| Molecular Weight | 200.96 |
| CAS Registry Number | 2896-87-9 |
| SMILES | [C@@H](N)(C([O-])=O)CCC([O-])=O.[Fe++] |
| InChI | 1S/C5H9NO4.Fe/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);/q;+2/p-2/t3-;/m0./s1 |
| InChIKey | ITYLKCDBOWEVQX-DFWYDOINSA-L |
| Boiling point | 333.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 155.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ferrous glutamate |