| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Georganics Ltd. | Slovakia | Inquire | ||
|---|---|---|---|---|
![]() |
+421 (33) 640-3132 | |||
![]() |
georganics@nextra.sk | |||
| Chemical manufacturer since 1998 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | Phenoxy-1,1'-Biphenyl |
|---|---|
| Synonyms | 1-(Phenoxy)-2-Phenyl-Benzene; Ether, 2-Biphenylyl Phenyl (8Ci); Zinc01693795 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14O |
| Molecular Weight | 246.31 |
| CAS Registry Number | 28984-89-6 |
| EINECS | 249-357-6 |
| SMILES | C1=CC=CC(=C1C2=CC=CC=C2)OC3=CC=CC=C3 |
| InChI | 1S/C18H14O/c1-3-9-15(10-4-1)17-13-7-8-14-18(17)19-16-11-5-2-6-12-16/h1-14H |
| InChIKey | UHJWZORSTYATLW-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 47-50°C (Expl.) |
| Boiling point | 347.15°C at 760 mmHg (Cal.) |
| Flash point | 174.1±17.8°C (Cal.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Phenoxy-1,1'-Biphenyl |