|
CAS#: 29092-13-5 Product: Ethyl Hydrogen Tetrabromoterephthalate No suppilers available for the product. |
| Name | Ethyl Hydrogen Tetrabromoterephthalate |
|---|---|
| Synonyms | 2,3,5,6-Tetrabromo-4-Ethoxycarbonyl-Benzoic Acid; 2,3,5,6-Tetrabromo-4-Carbethoxy-Benzoic Acid; Ethyl Hydrogen Tetrabromoterephthalate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6Br4O4 |
| Molecular Weight | 509.77 |
| CAS Registry Number | 29092-13-5 |
| EINECS | 249-422-9 |
| SMILES | C(OC(C1=C(C(=C(C(=C1Br)Br)C(=O)O)Br)Br)=O)C |
| InChI | 1S/C10H6Br4O4/c1-2-18-10(17)4-7(13)5(11)3(9(15)16)6(12)8(4)14/h2H2,1H3,(H,15,16) |
| InChIKey | OMUHVEKJVPWWEH-UHFFFAOYSA-N |
| Density | 2.306g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.905°C at 760 mmHg (Cal.) |
| Flash point | 239.804°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl Hydrogen Tetrabromoterephthalate |