|
CAS#: 29181-69-9 Product: 4-Methyl-6-(Trifluoromethyl)-1,3,5-Triazin-2-Amine No suppilers available for the product. |
| Name | 4-Methyl-6-(Trifluoromethyl)-1,3,5-Triazin-2-Amine |
|---|---|
| Synonyms | [4-Methyl-6-(Trifluoromethyl)-S-Triazin-2-Yl]Amine; 2-Amino-4-Methyl-6-(Trifluoromethyl)-S-Triazine; S-Triazine, 2-Amino-4-Methyl-6-(Trifluoromethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C5H5F3N4 |
| Molecular Weight | 178.12 |
| CAS Registry Number | 29181-69-9 |
| SMILES | CC1=NC(=NC(=N1)N)C(F)(F)F |
| InChI | 1S/C5H5F3N4/c1-2-10-3(5(6,7)8)12-4(9)11-2/h1H3,(H2,9,10,11,12) |
| InChIKey | JTQYLAFRKZQYMF-UHFFFAOYSA-N |
| Density | 1.47g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.446°C at 760 mmHg (Cal.) |
| Flash point | 119.781°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-6-(Trifluoromethyl)-1,3,5-Triazin-2-Amine |