|
CAS#: 2924-25-6 Product: 1-(1-Propenyl)-3-(Trifluoromethyl)Benzene No suppilers available for the product. |
| Name | 1-(1-Propenyl)-3-(Trifluoromethyl)Benzene |
|---|---|
| Synonyms | 1-(1-Propenyl)-3-(Trifluoromethyl)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9F3 |
| Molecular Weight | 186.18 |
| CAS Registry Number | 2924-25-6 |
| EINECS | 220-888-5 |
| SMILES | C1=C(C=CC=C1\C=C\C)C(F)(F)F |
| InChI | 1S/C10H9F3/c1-2-4-8-5-3-6-9(7-8)10(11,12)13/h2-7H,1H3/b4-2+ |
| InChIKey | OUZWHCIDWBRHFD-DUXPYHPUSA-N |
| Density | 1.136g/cm3 (Cal.) |
|---|---|
| Boiling point | 192.706°C at 760 mmHg (Cal.) |
| Flash point | 61.213°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1-Propenyl)-3-(Trifluoromethyl)Benzene |