|
CAS#: 29454-06-6 Product: Decanoic Acid, 2-Sulfoethyl Ester, Sodium Salt (1:1) No suppilers available for the product. |
| Name | Decanoic Acid, 2-Sulfoethyl Ester, Sodium Salt (1:1) |
|---|---|
| Synonyms | sodium 2-sulphoethyl decanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H24NaO5S |
| Molecular Weight | 303.37 |
| CAS Registry Number | 29454-06-6 |
| EINECS | 249-638-3 |
| SMILES | [Na+].O=C(OCCS(O)(=O)=O)CCCCCCCCC |
| InChI | 1S/C12H24O5S.Na/c1-2-3-4-5-6-7-8-9-12(13)17-10-11-18(14,15)16;/h2-11H2,1H3,(H,14,15,16);/q;+1 |
| InChIKey | BUGBPNOGBVBQSY-UHFFFAOYSA-N |
| Refractive index | (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Decanoic Acid, 2-Sulfoethyl Ester, Sodium Salt (1:1) |