|
CAS#: 29590-61-2 Product: N-(2-Octanyl)-N'-Phenyl-1,4-Benzenediamine No suppilers available for the product. |
| Name | N-(2-Octanyl)-N'-Phenyl-1,4-Benzenediamine |
|---|---|
| Synonyms | N-(2-Octyl)-N'-phenyl-1,4-benzenediamine |
| Molecular Structure | ![]() |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.45 |
| CAS Registry Number | 29590-61-2 |
| SMILES | N(c1ccc(cc1)Nc2ccccc2)C(CCCCCC)C |
| InChI | 1S/C20H28N2/c1-3-4-5-7-10-17(2)21-19-13-15-20(16-14-19)22-18-11-8-6-9-12-18/h6,8-9,11-17,21-22H,3-5,7,10H2,1-2H3 |
| InChIKey | JQTYAZKTBXWQOM-UHFFFAOYSA-N |
| Density | 1.019g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.336°C at 760 mmHg (Cal.) |
| Flash point | 263.892°C (Cal.) |
| Refractive index | 1.586 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Octanyl)-N'-Phenyl-1,4-Benzenediamine |