|
CAS#: 29595-61-7 Product: Trichloronitrobenzene No suppilers available for the product. |
| Name | Trichloronitrobenzene |
|---|---|
| Synonyms | 1,2,3-Trichloro-4-Nitro-Benzene; Benzene, 1,2,3-Trichloro-4-Nitro- (8Ci)(9Ci); Benzene, 4-Nitro-1,2,3-Trichloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H2Cl3NO2 |
| Molecular Weight | 226.45 |
| CAS Registry Number | 29595-61-7 |
| EINECS | 249-716-7 |
| SMILES | C1=C([N+]([O-])=O)C(=C(Cl)C(=C1)Cl)Cl |
| InChI | 1S/C6H2Cl3NO2/c7-3-1-2-4(10(11)12)6(9)5(3)8/h1-2H |
| InChIKey | BGKIECJVXXHLDP-UHFFFAOYSA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 56°C (Expl.) |
| Boiling point | 296.2±35.0°C at 760 mmHg (Cal.) |
| Flash point | 110°C (Expl.) |
| 133.0±25.9°C (Cal.) | |
| Safety Code | S26;S36/37 Details |
|---|---|
| Risk Code | R20/21/22;R36/37/38 Details |
| Hazard Symbol | X Details |
| Transport Information | UN2811 |
| Safety Description | DANGER: POISON, irritates skin, eyes, lungs |
| Market Analysis Reports |
| List of Reports Available for Trichloronitrobenzene |